C24H23BrN2O4S2 — CID 19188053
ethyl 4-(4-bromophenyl)-2-[[2-(2,5-dimethylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19188053) has the molecular formula C24H23BrN2O4S2 and a molecular weight of 547.50 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[[2-(2,5-dimethylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[[2-(2,5-dimethylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19188053 |
| Molecular Formula | C24H23BrN2O4S2 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[[2-(2,5-dimethylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=S)NC(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C24H23BrN2O4S2/c1-4-30-23(29)21-18(16-7-9-17(25)10-8-16)13-33-22(21)27-24(32)26-20(28)12-31-19-11-14(2)5-6-15(19)3/h5-11,13H,4,12H2,1-3H3,(H2,26,27,28,32) |
| InChIKey | VVORDQHUVCRFFJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|