C23H22BrNO5S — CID 4095038
ethyl 4-(4-bromophenyl)-2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 4095038) has the molecular formula C23H22BrNO5S and a molecular weight of 504.40 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4095038 |
| Molecular Formula | C23H22BrNO5S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[[2-(3,4-dimethoxyphenyl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H22BrNO5S/c1-4-30-23(27)21-17(15-6-8-16(24)9-7-15)13-31-22(21)25-20(26)12-14-5-10-18(28-2)19(11-14)29-3/h5-11,13H,4,12H2,1-3H3,(H,25,26) |
| InChIKey | ZXLXOTZETJGUEU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|