C23H23NO7S2 — CID 4782974
ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 4782974) has the molecular formula C23H23NO7S2 and a molecular weight of 489.57 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4782974 |
| Molecular Formula | C23H23NO7S2 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)COC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H23NO7S2/c1-4-30-23(27)21-15(18-6-5-9-32-18)13-33-22(21)24-19(25)12-31-20(26)11-14-7-8-16(28-2)17(10-14)29-3/h5-10,13H,4,11-12H2,1-3H3,(H,24,25) |
| InChIKey | QZFZHLLUCJEMKD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|