C27H31NO5S — CID 19221565
ethyl 4-(3,4-dimethoxyphenyl)-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate (PubChem CID 19221565) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethoxyphenyl)-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethoxyphenyl)-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19221565 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | ethyl 4-(3,4-dimethoxyphenyl)-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1NC(=O)CCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H31NO5S/c1-6-33-27(30)25-21(20-12-13-22(31-4)23(15-20)32-5)16-34-26(25)28-24(29)14-9-18-7-10-19(11-8-18)17(2)3/h7-8,10-13,15-17H,6,9,14H2,1-5H3,(H,28,29) |
| InChIKey | QRXAUVNGFJWMAX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|