C26H28ClNO6S — CID 19191312
ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (PubChem CID 19191312) has the molecular formula C26H28ClNO6S and a molecular weight of 518.03 g/mol. Its IUPAC name is ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19191312 |
| Molecular Formula | C26H28ClNO6S |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | ethyl 2-[4-(4-chloro-3-methylphenoxy)butanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1NC(=O)CCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C26H28ClNO6S/c1-5-33-26(30)24-19(17-8-11-21(31-3)22(14-17)32-4)15-35-25(24)28-23(29)7-6-12-34-18-9-10-20(27)16(2)13-18/h8-11,13-15H,5-7,12H2,1-4H3,(H,28,29) |
| InChIKey | NWNRFGXJSHLAGG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|