C27H30FNO4S — CID 2072403
ethyl 4-(4-fluorophenyl)-2-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate (PubChem CID 2072403) has the molecular formula C27H30FNO4S and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2072403 |
| Molecular Formula | C27H30FNO4S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CCCOc1ccc(C(C)C)c(C)c1 |
| InChI | InChI=1S/C27H30FNO4S/c1-5-32-27(31)25-23(19-8-10-20(28)11-9-19)16-34-26(25)29-24(30)7-6-14-33-21-12-13-22(17(2)3)18(4)15-21/h8-13,15-17H,5-7,14H2,1-4H3,(H,29,30) |
| InChIKey | GRUHKNSYLIFHSW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|