C24H23ClFNO4S — CID 4083443
ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 4083443) has the molecular formula C24H23ClFNO4S and a molecular weight of 475.97 g/mol. Its IUPAC name is ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4083443 |
| Molecular Formula | C24H23ClFNO4S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | ethyl 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C(C)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C24H23ClFNO4S/c1-5-30-24(29)20-19(16-6-8-17(26)9-7-16)12-32-23(20)27-22(28)15(4)31-18-10-13(2)21(25)14(3)11-18/h6-12,15H,5H2,1-4H3,(H,27,28) |
| InChIKey | JEDDWRSDSBWUST-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|