C28H33NO6S — CID 3611949
ethyl 2-[2-(4-tert-butylphenoxy)propanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (PubChem CID 3611949) has the molecular formula C28H33NO6S and a molecular weight of 511.64 g/mol. Its IUPAC name is ethyl 2-[2-(4-tert-butylphenoxy)propanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(4-tert-butylphenoxy)propanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3611949 |
| Molecular Formula | C28H33NO6S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | ethyl 2-[2-(4-tert-butylphenoxy)propanoylamino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1NC(=O)C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H33NO6S/c1-8-34-27(31)24-21(18-9-14-22(32-6)23(15-18)33-7)16-36-26(24)29-25(30)17(2)35-20-12-10-19(11-13-20)28(3,4)5/h9-17H,8H2,1-7H3,(H,29,30) |
| InChIKey | WHGHAPKJLLJVGN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|