C23H27NO7S — CID 28698161
trans-(1R,2R)-2-[[4-(3,4-dimethoxyphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 28698161) has the molecular formula C23H27NO7S and a molecular weight of 461.54 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[4-(3,4-dimethoxyphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[[4-(3,4-dimethoxyphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 28698161 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | trans-(1R,2R)-2-[[4-(3,4-dimethoxyphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1NC(=O)[C@@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C23H27NO7S/c1-4-31-23(28)19-16(13-9-10-17(29-2)18(11-13)30-3)12-32-21(19)24-20(25)14-7-5-6-8-15(14)22(26)27/h9-12,14-15H,4-8H2,1-3H3,(H,24,25)(H,26,27)/t14-,15-/m1/s1 |
| InChIKey | NJWDDNUUEVHNCQ-HUUCEWRRSA-N |
| XLogP | 4.44 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|