C32H32N2O5S — CID 7905662
ethyl 2-[[4-[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]oxybenzoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 7905662) has the molecular formula C32H32N2O5S and a molecular weight of 556.68 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]oxybenzoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]oxybenzoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7905662 |
| Molecular Formula | C32H32N2O5S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | ethyl 2-[[4-[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl]oxybenzoyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)c1ccc(O[C@H](C)C(=O)Nc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C32H32N2O5S/c1-5-22-9-15-25(16-10-22)33-29(35)21(4)39-26-17-13-24(14-18-26)30(36)34-31-28(32(37)38-6-2)27(19-40-31)23-11-7-20(3)8-12-23/h7-19,21H,5-6H2,1-4H3,(H,33,35)(H,34,36)/t21-/m1/s1 |
| InChIKey | JDXKDDGDKNZHCA-OAQYLSRUSA-N |
| XLogP | 7.12 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|