C16H16FNO3S — CID 5121938
methyl 4-(4-fluorophenyl)-2-(2-methylpropanoylamino)thiophene-3-carboxylate (PubChem CID 5121938) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-(2-methylpropanoylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-(2-methylpropanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5121938 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-(2-methylpropanoylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C(C)C |
| InChI | InChI=1S/C16H16FNO3S/c1-9(2)14(19)18-15-13(16(20)21-3)12(8-22-15)10-4-6-11(17)7-5-10/h4-9H,1-3H3,(H,18,19) |
| InChIKey | ZIDYUVBSMSHRKF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|