C17H14Br2FNO3S — CID 17285294
methyl 2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 17285294) has the molecular formula C17H14Br2FNO3S and a molecular weight of 491.18 g/mol. Its IUPAC name is methyl 2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17285294 |
| Molecular Formula | C17H14Br2FNO3S |
| Molecular Weight | 491.18 g/mol |
| Exact Mass | 488.90 |
| IUPAC Name | methyl 2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C1(C)CC1(Br)Br |
| InChI | InChI=1S/C17H14Br2FNO3S/c1-16(8-17(16,18)19)15(23)21-13-12(14(22)24-2)11(7-25-13)9-3-5-10(20)6-4-9/h3-7H,8H2,1-2H3,(H,21,23) |
| InChIKey | BLFHBQKJLYEYNH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.18 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|