C19H17Cl2FN2O3S2 — CID 2375639
ethyl 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 2375639) has the molecular formula C19H17Cl2FN2O3S2 and a molecular weight of 475.39 g/mol. Its IUPAC name is ethyl 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2375639 |
| Molecular Formula | C19H17Cl2FN2O3S2 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | ethyl 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=S)NC(=O)[C@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C19H17Cl2FN2O3S2/c1-3-27-15(25)13-12(10-4-6-11(22)7-5-10)8-29-14(13)23-17(28)24-16(26)18(2)9-19(18,20)21/h4-8H,3,9H2,1-2H3,(H2,23,24,26,28)/t18-/m0/s1 |
| InChIKey | IWDZOUGXABTLKB-SFHVURJKSA-N |
| XLogP | 5.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|