C16H20Cl2N2O3S2 — CID 2373718
ethyl 2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 2373718) has the molecular formula C16H20Cl2N2O3S2 and a molecular weight of 423.39 g/mol. Its IUPAC name is ethyl 2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2373718 |
| Molecular Formula | C16H20Cl2N2O3S2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | ethyl 2-[[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)[C@@]2(C)CC2(Cl)Cl)sc(C)c1CC |
| InChI | InChI=1S/C16H20Cl2N2O3S2/c1-5-9-8(3)25-11(10(9)12(21)23-6-2)19-14(24)20-13(22)15(4)7-16(15,17)18/h5-7H2,1-4H3,(H2,19,20,22,24)/t15-/m1/s1 |
| InChIKey | NUQGOFZTMNYIOA-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|