C13H18ClNO3S — CID 43132157
ethyl 2-(2-chloropropanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 43132157) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is ethyl 2-(2-chloropropanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(2-chloropropanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 43132157 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | ethyl 2-(2-chloropropanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Cl)sc(C)c1CC |
| InChI | InChI=1S/C13H18ClNO3S/c1-5-9-8(4)19-12(15-11(16)7(3)14)10(9)13(17)18-6-2/h7H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | BOVADVZNQLONPJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|