C16H17ClN2O3S — CID 52895368
ethyl 2-[(6-chloropyridine-3-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 52895368) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is ethyl 2-[(6-chloropyridine-3-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(6-chloropyridine-3-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 52895368 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | ethyl 2-[(6-chloropyridine-3-carbonyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(Cl)nc2)sc(C)c1CC |
| InChI | InChI=1S/C16H17ClN2O3S/c1-4-11-9(3)23-15(13(11)16(21)22-5-2)19-14(20)10-6-7-12(17)18-8-10/h6-8H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | VFRUCGLESXSHLJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|