C15H12ClN3O3S — CID 71580268
ethyl 5-[(6-chloropyridine-3-carbonyl)amino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 71580268) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is ethyl 5-[(6-chloropyridine-3-carbonyl)amino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[(6-chloropyridine-3-carbonyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 71580268 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | ethyl 5-[(6-chloropyridine-3-carbonyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(Cl)nc2)c(C#N)c1C |
| InChI | InChI=1S/C15H12ClN3O3S/c1-3-22-15(21)12-8(2)10(6-17)14(23-12)19-13(20)9-4-5-11(16)18-7-9/h4-5,7H,3H2,1-2H3,(H,19,20) |
| InChIKey | NMBVVJFDXMHVGU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|