C20H21N3O6S2 — CID 41006259
ethyl 4-cyano-3-methyl-5-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate (PubChem CID 41006259) has the molecular formula C20H21N3O6S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is ethyl 4-cyano-3-methyl-5-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-methyl-5-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 41006259 |
| Molecular Formula | C20H21N3O6S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | ethyl 4-cyano-3-methyl-5-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)c(C#N)c1C |
| InChI | InChI=1S/C20H21N3O6S2/c1-3-29-20(25)17-13(2)16(12-21)19(30-17)22-18(24)14-4-6-15(7-5-14)31(26,27)23-8-10-28-11-9-23/h4-7H,3,8-11H2,1-2H3,(H,22,24) |
| InChIKey | WWQHXGFUXZVMQF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |