C24H26N4O4S2 — CID 3575474
1-N,4-N-bis(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)benzene-1,4-dicarboxamide (PubChem CID 3575474) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-N,4-N-bis(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3575474 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-N,4-N-bis(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)benzene-1,4-dicarboxamide |
| SMILES | CCc1c(C)sc(NC(=O)c2ccc(C(=O)Nc3sc(C)c(CC)c3C(N)=O)cc2)c1C(N)=O |
| InChI | InChI=1S/C24H26N4O4S2/c1-5-15-11(3)33-23(17(15)19(25)29)27-21(31)13-7-9-14(10-8-13)22(32)28-24-18(20(26)30)16(6-2)12(4)34-24/h7-10H,5-6H2,1-4H3,(H2,25,29)(H2,26,30)(H,27,31)(H,28,32) |
| InChIKey | QTVKBDDEYXPBQQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |