C19H23BrN2O3S — CID 17168931
2-[[3-bromo-4-(2-methylpropoxy)benzoyl]amino]-4-ethyl-5-methylthiophene-3-carboxamide (PubChem CID 17168931) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-[[3-bromo-4-(2-methylpropoxy)benzoyl]amino]-4-ethyl-5-methylthiophene-3-carboxamide.
| Compound Name | 2-[[3-bromo-4-(2-methylpropoxy)benzoyl]amino]-4-ethyl-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17168931 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-[[3-bromo-4-(2-methylpropoxy)benzoyl]amino]-4-ethyl-5-methylthiophene-3-carboxamide |
| SMILES | CCc1c(C)sc(NC(=O)c2ccc(OCC(C)C)c(Br)c2)c1C(N)=O |
| InChI | InChI=1S/C19H23BrN2O3S/c1-5-13-11(4)26-19(16(13)17(21)23)22-18(24)12-6-7-15(14(20)8-12)25-9-10(2)3/h6-8,10H,5,9H2,1-4H3,(H2,21,23)(H,22,24) |
| InChIKey | HDJQCWLPDBGNTD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |