C22H22N2O2S — CID 2930937
2-[(2,2-diphenylacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide (PubChem CID 2930937) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide.
| Compound Name | 2-[(2,2-diphenylacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 2930937 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)amino]-4-ethyl-5-methylthiophene-3-carboxamide |
| SMILES | CCc1c(C)sc(NC(=O)C(c2ccccc2)c2ccccc2)c1C(N)=O |
| InChI | InChI=1S/C22H22N2O2S/c1-3-17-14(2)27-22(19(17)20(23)25)24-21(26)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,18H,3H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | DWIDQQDDHJJEHM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |