C13H13BrN2O3S — CID 1222183
5-bromo-N-(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)furan-2-carboxamide (PubChem CID 1222183) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 5-bromo-N-(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1222183 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 5-bromo-N-(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)furan-2-carboxamide |
| SMILES | CCc1c(C)sc(NC(=O)c2ccc(Br)o2)c1C(N)=O |
| InChI | InChI=1S/C13H13BrN2O3S/c1-3-7-6(2)20-13(10(7)11(15)17)16-12(18)8-4-5-9(14)19-8/h4-5H,3H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | ALURRQVZMRUHGX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |