C21H19NO3S — CID 1318924
2-[(2,2-diphenylacetyl)amino]-4,5-dimethylthiophene-3-carboxylic acid (PubChem CID 1318924) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-[(2,2-diphenylacetyl)amino]-4,5-dimethylthiophene-3-carboxylic acid.
| Compound Name | 2-[(2,2-diphenylacetyl)amino]-4,5-dimethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 1318924 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[(2,2-diphenylacetyl)amino]-4,5-dimethylthiophene-3-carboxylic acid |
| SMILES | Cc1sc(NC(=O)C(c2ccccc2)c2ccccc2)c(C(=O)O)c1C |
| InChI | InChI=1S/C21H19NO3S/c1-13-14(2)26-20(17(13)21(24)25)22-19(23)18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,18H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | LHNRQKHYFWGBQD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |