C14H23ClN2O3S — CID 119677230
ethyl 2-(3-aminobutanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate;hydrochloride (PubChem CID 119677230) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is ethyl 2-(3-aminobutanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate;hydrochloride.
| Compound Name | ethyl 2-(3-aminobutanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119677230 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | ethyl 2-(3-aminobutanoylamino)-4-ethyl-5-methylthiophene-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(NC(=O)CC(C)N)sc(C)c1CC.Cl |
| InChI | InChI=1S/C14H22N2O3S.ClH/c1-5-10-9(4)20-13(12(10)14(18)19-6-2)16-11(17)7-8(3)15;/h8H,5-7,15H2,1-4H3,(H,16,17);1H |
| InChIKey | KSOKWBOTWUBESM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |