C19H24N2O3S2 — CID 8659208
ethyl 2-[(4-ethoxyphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 8659208) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is ethyl 2-[(4-ethoxyphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-ethoxyphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8659208 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | ethyl 2-[(4-ethoxyphenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccc(OCC)cc2)sc(C)c1CC |
| InChI | InChI=1S/C19H24N2O3S2/c1-5-15-12(4)26-17(16(15)18(22)24-7-3)21-19(25)20-13-8-10-14(11-9-13)23-6-2/h8-11H,5-7H2,1-4H3,(H2,20,21,25) |
| InChIKey | BQYSFJGCPWECQN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|