C17H18F2N2O3S2 — CID 7943805
ethyl 2-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 7943805) has the molecular formula C17H18F2N2O3S2 and a molecular weight of 400.47 g/mol. Its IUPAC name is ethyl 2-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7943805 |
| Molecular Formula | C17H18F2N2O3S2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | ethyl 2-[[4-(difluoromethoxy)phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccc(OC(F)F)cc2)sc(C)c1C |
| InChI | InChI=1S/C17H18F2N2O3S2/c1-4-23-15(22)13-9(2)10(3)26-14(13)21-17(25)20-11-5-7-12(8-6-11)24-16(18)19/h5-8,16H,4H2,1-3H3,(H2,20,21,25) |
| InChIKey | VFPNUPDMPSKQHO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|