C22H19F3N2O3S2 — CID 19680351
ethyl 5-methyl-4-phenyl-2-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 19680351) has the molecular formula C22H19F3N2O3S2 and a molecular weight of 480.53 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenyl-2-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-phenyl-2-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19680351 |
| Molecular Formula | C22H19F3N2O3S2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | ethyl 5-methyl-4-phenyl-2-[[4-(trifluoromethoxy)phenyl]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccc(OC(F)(F)F)cc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H19F3N2O3S2/c1-3-29-20(28)18-17(14-7-5-4-6-8-14)13(2)32-19(18)27-21(31)26-15-9-11-16(12-10-15)30-22(23,24)25/h4-12H,3H2,1-2H3,(H2,26,27,31) |
| InChIKey | FEHAHFYOUGVUCZ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|