C22H29NO4S — CID 7703410
ethyl 2-[[2-(4-tert-butylphenoxy)acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 7703410) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is ethyl 2-[[2-(4-tert-butylphenoxy)acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-tert-butylphenoxy)acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7703410 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | ethyl 2-[[2-(4-tert-butylphenoxy)acetyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2ccc(C(C)(C)C)cc2)sc(C)c1CC |
| InChI | InChI=1S/C22H29NO4S/c1-7-17-14(3)28-20(19(17)21(25)26-8-2)23-18(24)13-27-16-11-9-15(10-12-16)22(4,5)6/h9-12H,7-8,13H2,1-6H3,(H,23,24) |
| InChIKey | LAJQTMMEOHUIQN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |