C23H17FN2O5S — CID 1039869
ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 1039869) has the molecular formula C23H17FN2O5S and a molecular weight of 452.46 g/mol. Its IUPAC name is ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1039869 |
| Molecular Formula | C23H17FN2O5S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H17FN2O5S/c1-2-31-23(30)19-17(13-7-9-14(24)10-8-13)12-32-20(19)25-18(27)11-26-21(28)15-5-3-4-6-16(15)22(26)29/h3-10,12H,2,11H2,1H3,(H,25,27) |
| InChIKey | NLXAOKJHVXJVBC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|