C25H21N3O5S2 — CID 19189121
ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 19189121) has the molecular formula C25H21N3O5S2 and a molecular weight of 507.59 g/mol. Its IUPAC name is ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19189121 |
| Molecular Formula | C25H21N3O5S2 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | ethyl 2-[3-(1,3-dioxoisoindol-2-yl)propanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=S)NC(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H21N3O5S2/c1-2-33-24(32)20-18(15-8-4-3-5-9-15)14-35-21(20)27-25(34)26-19(29)12-13-28-22(30)16-10-6-7-11-17(16)23(28)31/h3-11,14H,2,12-13H2,1H3,(H2,26,27,29,34) |
| InChIKey | HYXQXUXDGCQHMF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|