C24H18BrN3O7S — CID 19184168
ethyl 4-(4-bromophenyl)-2-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]thiophene-3-carboxylate (PubChem CID 19184168) has the molecular formula C24H18BrN3O7S and a molecular weight of 572.39 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19184168 |
| Molecular Formula | C24H18BrN3O7S |
| Molecular Weight | 572.39 g/mol |
| Exact Mass | 571.00 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C24H18BrN3O7S/c1-2-35-24(32)20-16(13-6-8-14(25)9-7-13)12-36-21(20)26-18(29)10-11-27-22(30)15-4-3-5-17(28(33)34)19(15)23(27)31/h3-9,12H,2,10-11H2,1H3,(H,26,29) |
| InChIKey | XLSUPFKPEPADGP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|