C22H17N3O8S — CID 55942796
ethyl 4-(furan-2-yl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]thiophene-3-carboxylate (PubChem CID 55942796) has the molecular formula C22H17N3O8S and a molecular weight of 483.46 g/mol. Its IUPAC name is ethyl 4-(furan-2-yl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(furan-2-yl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55942796 |
| Molecular Formula | C22H17N3O8S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | ethyl 4-(furan-2-yl)-2-[[(2S)-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)[C@H](C)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C22H17N3O8S/c1-3-32-22(29)17-13(15-8-5-9-33-15)10-34-19(17)23-18(26)11(2)24-20(27)12-6-4-7-14(25(30)31)16(12)21(24)28/h4-11H,3H2,1-2H3,(H,23,26)/t11-/m0/s1 |
| InChIKey | WFHMKVWKLWDHPR-NSHDSACASA-N |
| XLogP | 3.72 |
| TPSA | 149.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|