C19H16N2O7S — CID 1014924
ethyl 4-(furan-2-yl)-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 1014924) has the molecular formula C19H16N2O7S and a molecular weight of 416.41 g/mol. Its IUPAC name is ethyl 4-(furan-2-yl)-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(furan-2-yl)-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 1014924 |
| Molecular Formula | C19H16N2O7S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | ethyl 4-(furan-2-yl)-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16N2O7S/c1-3-27-19(23)16-12(14-5-4-8-28-14)10-29-18(16)20-17(22)11-6-7-15(26-2)13(9-11)21(24)25/h4-10H,3H2,1-2H3,(H,20,22) |
| InChIKey | UBTMHUHQGPUAFM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|