C22H18N2O10S — CID 16796644
3-O-[2-[[3-ethoxycarbonyl-4-(furan-2-yl)thiophen-2-yl]amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 16796644) has the molecular formula C22H18N2O10S and a molecular weight of 502.46 g/mol. Its IUPAC name is 3-O-[2-[[3-ethoxycarbonyl-4-(furan-2-yl)thiophen-2-yl]amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[2-[[3-ethoxycarbonyl-4-(furan-2-yl)thiophen-2-yl]amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 16796644 |
| Molecular Formula | C22H18N2O10S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-O-[2-[[3-ethoxycarbonyl-4-(furan-2-yl)thiophen-2-yl]amino]-2-oxoethyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)COC(=O)c1cc(C(=O)OC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N2O10S/c1-3-32-22(28)18-15(16-5-4-6-33-16)11-35-19(18)23-17(25)10-34-21(27)13-7-12(20(26)31-2)8-14(9-13)24(29)30/h4-9,11H,3,10H2,1-2H3,(H,23,25) |
| InChIKey | XMFOCLLJLVMKDL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|