C19H16FNO5S — CID 7834644
ethyl 2-[[2-(3-fluorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate (PubChem CID 7834644) has the molecular formula C19H16FNO5S and a molecular weight of 389.40 g/mol. Its IUPAC name is ethyl 2-[[2-(3-fluorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-fluorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7834644 |
| Molecular Formula | C19H16FNO5S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | ethyl 2-[[2-(3-fluorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)COc1cccc(F)c1 |
| InChI | InChI=1S/C19H16FNO5S/c1-2-24-19(23)17-14(15-7-4-8-25-15)11-27-18(17)21-16(22)10-26-13-6-3-5-12(20)9-13/h3-9,11H,2,10H2,1H3,(H,21,22) |
| InChIKey | OMPTZYPAORVYKS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |