C21H18N2O8S — CID 16958710
ethyl 4-(furan-2-yl)-2-[[2-(3-methyl-4-nitrobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 16958710) has the molecular formula C21H18N2O8S and a molecular weight of 458.45 g/mol. Its IUPAC name is ethyl 4-(furan-2-yl)-2-[[2-(3-methyl-4-nitrobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(furan-2-yl)-2-[[2-(3-methyl-4-nitrobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 16958710 |
| Molecular Formula | C21H18N2O8S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | ethyl 4-(furan-2-yl)-2-[[2-(3-methyl-4-nitrobenzoyl)oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)COC(=O)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C21H18N2O8S/c1-3-29-21(26)18-14(16-5-4-8-30-16)11-32-19(18)22-17(24)10-31-20(25)13-6-7-15(23(27)28)12(2)9-13/h4-9,11H,3,10H2,1-2H3,(H,22,24) |
| InChIKey | NYGZJWYUJUKAMH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|