C19H16ClNO5S — CID 3430221
ethyl 2-[[2-(2-chlorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate (PubChem CID 3430221) has the molecular formula C19H16ClNO5S and a molecular weight of 405.86 g/mol. Its IUPAC name is ethyl 2-[[2-(2-chlorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-chlorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3430221 |
| Molecular Formula | C19H16ClNO5S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | ethyl 2-[[2-(2-chlorophenoxy)acetyl]amino]-4-(furan-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C19H16ClNO5S/c1-2-24-19(23)17-12(14-8-5-9-25-14)11-27-18(17)21-16(22)10-26-15-7-4-3-6-13(15)20/h3-9,11H,2,10H2,1H3,(H,21,22) |
| InChIKey | YCFUPGQADPYESB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |