C18H15ClN2O4S — CID 2809305
ethyl 2-[(4-chlorophenyl)carbamoylamino]-4-(furan-2-yl)thiophene-3-carboxylate (PubChem CID 2809305) has the molecular formula C18H15ClN2O4S and a molecular weight of 390.85 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)carbamoylamino]-4-(furan-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-chlorophenyl)carbamoylamino]-4-(furan-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2809305 |
| Molecular Formula | C18H15ClN2O4S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)carbamoylamino]-4-(furan-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccco2)csc1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN2O4S/c1-2-24-17(22)15-13(14-4-3-9-25-14)10-26-16(15)21-18(23)20-12-7-5-11(19)6-8-12/h3-10H,2H2,1H3,(H2,20,21,23) |
| InChIKey | NVVUZLNPMYOMQV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |