C24H19N3O8S — CID 110496180
ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 110496180) has the molecular formula C24H19N3O8S and a molecular weight of 509.50 g/mol. Its IUPAC name is ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110496180 |
| Molecular Formula | C24H19N3O8S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[(4-methoxy-3-nitrobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)sc1NC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19N3O8S/c1-3-35-24(31)17-11-14(12-26-22(29)15-6-4-5-7-16(15)23(26)30)36-21(17)25-20(28)13-8-9-19(34-2)18(10-13)27(32)33/h4-11H,3,12H2,1-2H3,(H,25,28) |
| InChIKey | LWPUOOXRVNWCQW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|