C24H22N2O6S2 — CID 110504734
ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate (PubChem CID 110504734) has the molecular formula C24H22N2O6S2 and a molecular weight of 498.58 g/mol. Its IUPAC name is ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110504734 |
| Molecular Formula | C24H22N2O6S2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | ethyl 2-[(3,4-dimethylphenyl)sulfonylamino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)sc1NS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C24H22N2O6S2/c1-4-32-24(29)20-12-16(13-26-22(27)18-7-5-6-8-19(18)23(26)28)33-21(20)25-34(30,31)17-10-9-14(2)15(3)11-17/h5-12,25H,4,13H2,1-3H3 |
| InChIKey | JFXQRMWHSDXKID-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|