C23H17BrN2O5S — CID 110496091
ethyl 2-[(4-bromobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate (PubChem CID 110496091) has the molecular formula C23H17BrN2O5S and a molecular weight of 513.37 g/mol. Its IUPAC name is ethyl 2-[(4-bromobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-bromobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110496091 |
| Molecular Formula | C23H17BrN2O5S |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | ethyl 2-[(4-bromobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)sc1NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H17BrN2O5S/c1-2-31-23(30)18-11-15(12-26-21(28)16-5-3-4-6-17(16)22(26)29)32-20(18)25-19(27)13-7-9-14(24)10-8-13/h3-11H,2,12H2,1H3,(H,25,27) |
| InChIKey | XWFJYPOUZRJHIG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|