C23H16F2N2O5S — CID 110496214
ethyl 2-[(2,5-difluorobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate (PubChem CID 110496214) has the molecular formula C23H16F2N2O5S and a molecular weight of 470.45 g/mol. Its IUPAC name is ethyl 2-[(2,5-difluorobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2,5-difluorobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110496214 |
| Molecular Formula | C23H16F2N2O5S |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | ethyl 2-[(2,5-difluorobenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)sc1NC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C23H16F2N2O5S/c1-2-32-23(31)17-10-13(11-27-21(29)14-5-3-4-6-15(14)22(27)30)33-20(17)26-19(28)16-9-12(24)7-8-18(16)25/h3-10H,2,11H2,1H3,(H,26,28) |
| InChIKey | FZVKJYNPYKQWHF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|