C26H23BrN2O8S — CID 110496175
ethyl 2-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate (PubChem CID 110496175) has the molecular formula C26H23BrN2O8S and a molecular weight of 603.45 g/mol. Its IUPAC name is ethyl 2-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110496175 |
| Molecular Formula | C26H23BrN2O8S |
| Molecular Weight | 603.45 g/mol |
| Exact Mass | 602.04 |
| IUPAC Name | ethyl 2-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]-5-[(1,3-dioxoisoindol-2-yl)methyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)sc1NC(=O)c1cc(OC)c(OC)c(OC)c1Br |
| InChI | InChI=1S/C26H23BrN2O8S/c1-5-37-26(33)17-10-13(12-29-24(31)14-8-6-7-9-15(14)25(29)32)38-23(17)28-22(30)16-11-18(34-2)20(35-3)21(36-4)19(16)27/h6-11H,5,12H2,1-4H3,(H,28,30) |
| InChIKey | KZZZGXJQWFIFOC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|