C24H17F3N2O5S — CID 110496170
ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[4-(trifluoromethyl)benzoyl]amino]thiophene-3-carboxylate (PubChem CID 110496170) has the molecular formula C24H17F3N2O5S and a molecular weight of 502.47 g/mol. Its IUPAC name is ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[4-(trifluoromethyl)benzoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[4-(trifluoromethyl)benzoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110496170 |
| Molecular Formula | C24H17F3N2O5S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[4-(trifluoromethyl)benzoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN2C(=O)c3ccccc3C2=O)sc1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H17F3N2O5S/c1-2-34-23(33)18-11-15(12-29-21(31)16-5-3-4-6-17(16)22(29)32)35-20(18)28-19(30)13-7-9-14(10-8-13)24(25,26)27/h3-11H,2,12H2,1H3,(H,28,30) |
| InChIKey | UYASAJBCWGVYTG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|