C28H26N2O6S — CID 110496192
ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 110496192) has the molecular formula C28H26N2O6S and a molecular weight of 518.59 g/mol. Its IUPAC name is ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110496192 |
| Molecular Formula | C28H26N2O6S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | ethyl 5-[(1,3-dioxoisoindol-2-yl)methyl]-2-[[(E)-3-(4-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Nc2sc(CN3C(=O)c4ccccc4C3=O)cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H26N2O6S/c1-3-15-36-19-12-9-18(10-13-19)11-14-24(31)29-25-23(28(34)35-4-2)16-20(37-25)17-30-26(32)21-7-5-6-8-22(21)27(30)33/h5-14,16H,3-4,15,17H2,1-2H3,(H,29,31)/b14-11+ |
| InChIKey | AQYJAQVYDQXBLY-SDNWHVSQSA-N |
| XLogP | 5.16 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|