C19H12F2N4O3S — CID 108744401
N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,5-difluorobenzamide (PubChem CID 108744401) has the molecular formula C19H12F2N4O3S and a molecular weight of 414.39 g/mol. Its IUPAC name is N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,5-difluorobenzamide.
| Compound Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 108744401 |
| Molecular Formula | C19H12F2N4O3S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,5-difluorobenzamide |
| SMILES | O=C(Nc1nnc(CCN2C(=O)c3ccccc3C2=O)s1)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H12F2N4O3S/c20-10-5-6-14(21)13(9-10)16(26)22-19-24-23-15(29-19)7-8-25-17(27)11-3-1-2-4-12(11)18(25)28/h1-6,9H,7-8H2,(H,22,24,26) |
| InChIKey | ZYMZWOUABFEMHF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|