C21H16FN5O4S — CID 108756241
N'-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-N-(4-fluorophenyl)butanediamide (PubChem CID 108756241) has the molecular formula C21H16FN5O4S and a molecular weight of 453.46 g/mol. Its IUPAC name is N'-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-N-(4-fluorophenyl)butanediamide.
| Compound Name | N'-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-N-(4-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 108756241 |
| Molecular Formula | C21H16FN5O4S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N'-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-N-(4-fluorophenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16FN5O4S/c22-12-5-7-13(8-6-12)23-16(28)9-10-17(29)24-21-26-25-18(32-21)11-27-19(30)14-3-1-2-4-15(14)20(27)31/h1-8H,9-11H2,(H,23,28)(H,24,26,29) |
| InChIKey | HIYWLWFMAYYXTA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|