C23H20N4O4S — CID 108744356
N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-5-oxo-5-phenylpentanamide (PubChem CID 108744356) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-5-oxo-5-phenylpentanamide.
| Compound Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-5-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 108744356 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-5-oxo-5-phenylpentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)Nc1nnc(CCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C23H20N4O4S/c28-18(15-7-2-1-3-8-15)11-6-12-19(29)24-23-26-25-20(32-23)13-14-27-21(30)16-9-4-5-10-17(16)22(27)31/h1-5,7-10H,6,11-14H2,(H,24,26,29) |
| InChIKey | OBPDRHVKNRUEDB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|