C23H22N4O4S — CID 108744348
N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2-(2,3,5-trimethylphenoxy)acetamide (PubChem CID 108744348) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2-(2,3,5-trimethylphenoxy)acetamide.
| Compound Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2-(2,3,5-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 108744348 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2-(2,3,5-trimethylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(C)c(OCC(=O)Nc2nnc(CCN3C(=O)c4ccccc4C3=O)s2)c1 |
| InChI | InChI=1S/C23H22N4O4S/c1-13-10-14(2)15(3)18(11-13)31-12-19(28)24-23-26-25-20(32-23)8-9-27-21(29)16-6-4-5-7-17(16)22(27)30/h4-7,10-11H,8-9,12H2,1-3H3,(H,24,26,28) |
| InChIKey | STBJTLZSNQABFI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|