C25H26N4O5S — CID 108766682
4-butoxy-N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide (PubChem CID 108766682) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is 4-butoxy-N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide.
| Compound Name | 4-butoxy-N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 108766682 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 4-butoxy-N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-3-ethoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2nnc(CCN3C(=O)c4ccccc4C3=O)s2)cc1OCC |
| InChI | InChI=1S/C25H26N4O5S/c1-3-5-14-34-19-11-10-16(15-20(19)33-4-2)22(30)26-25-28-27-21(35-25)12-13-29-23(31)17-8-6-7-9-18(17)24(29)32/h6-11,15H,3-5,12-14H2,1-2H3,(H,26,28,30) |
| InChIKey | RUGYXOILKJPBOH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|